C21H37N3O4 — CID 108919554
tert-butyl N-[3-[4-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate (PubChem CID 108919554) has the molecular formula C21H37N3O4 and a molecular weight of 395.54 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919554 |
| Molecular Formula | C21H37N3O4 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | tert-butyl N-[3-[4-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]piperidin-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)/C=C/C(=O)NCC1CCN(C(=O)CCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H37N3O4/c1-20(2,3)11-7-17(25)23-15-16-9-13-24(14-10-16)18(26)8-12-22-19(27)28-21(4,5)6/h7,11,16H,8-10,12-15H2,1-6H3,(H,22,27)(H,23,25)/b11-7+ |
| InChIKey | OLQXFHMVNIZEFI-YRNVUSSQSA-N |
| XLogP | 2.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|