C18H33N3O4 — CID 108555481
tert-butyl N-[3-oxo-3-[4-(pentanoylamino)piperidin-1-yl]propyl]carbamate (PubChem CID 108555481) has the molecular formula C18H33N3O4 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[4-(pentanoylamino)piperidin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[4-(pentanoylamino)piperidin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 108555481 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[4-(pentanoylamino)piperidin-1-yl]propyl]carbamate |
| SMILES | CCCCC(=O)NC1CCN(C(=O)CCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H33N3O4/c1-5-6-7-15(22)20-14-9-12-21(13-10-14)16(23)8-11-19-17(24)25-18(2,3)4/h14H,5-13H2,1-4H3,(H,19,24)(H,20,22) |
| InChIKey | UJDLIHULHQZMBS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |