C20H35N3O4 — CID 108919770
tert-butyl N-[3-[[1-[(E)-4,4-dimethylpent-2-enoyl]piperidin-4-yl]amino]-3-oxopropyl]carbamate (PubChem CID 108919770) has the molecular formula C20H35N3O4 and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-[(E)-4,4-dimethylpent-2-enoyl]piperidin-4-yl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-[(E)-4,4-dimethylpent-2-enoyl]piperidin-4-yl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919770 |
| Molecular Formula | C20H35N3O4 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | tert-butyl N-[3-[[1-[(E)-4,4-dimethylpent-2-enoyl]piperidin-4-yl]amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)/C=C/C(=O)N1CCC(NC(=O)CCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H35N3O4/c1-19(2,3)11-7-17(25)23-13-9-15(10-14-23)22-16(24)8-12-21-18(26)27-20(4,5)6/h7,11,15H,8-10,12-14H2,1-6H3,(H,21,26)(H,22,24)/b11-7+ |
| InChIKey | UUGXCJNSVBYFNR-YRNVUSSQSA-N |
| XLogP | 2.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|