C13H24N2O3S — CID 115599752
tert-butyl N-[3-oxo-3-(thian-4-ylamino)propyl]carbamate (PubChem CID 115599752) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-(thian-4-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-(thian-4-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 115599752 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl N-[3-oxo-3-(thian-4-ylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NC1CCSCC1 |
| InChI | InChI=1S/C13H24N2O3S/c1-13(2,3)18-12(17)14-7-4-11(16)15-10-5-8-19-9-6-10/h10H,4-9H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | LDHMTSHLQSYQGR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |