C20H29N3O4S — CID 108548266
tert-butyl N-[3-oxo-3-[[1-(2-sulfanylbenzoyl)piperidin-4-yl]amino]propyl]carbamate (PubChem CID 108548266) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[1-(2-sulfanylbenzoyl)piperidin-4-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[1-(2-sulfanylbenzoyl)piperidin-4-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 108548266 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[1-(2-sulfanylbenzoyl)piperidin-4-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NC1CCN(C(=O)c2ccccc2S)CC1 |
| InChI | InChI=1S/C20H29N3O4S/c1-20(2,3)27-19(26)21-11-8-17(24)22-14-9-12-23(13-10-14)18(25)15-6-4-5-7-16(15)28/h4-7,14,28H,8-13H2,1-3H3,(H,21,26)(H,22,24) |
| InChIKey | LAPKGYBFMSEPRP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|