C20H28BrN3O4 — CID 108919588
tert-butyl N-[3-[[1-(2-bromobenzoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate (PubChem CID 108919588) has the molecular formula C20H28BrN3O4 and a molecular weight of 454.37 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-(2-bromobenzoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-(2-bromobenzoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919588 |
| Molecular Formula | C20H28BrN3O4 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | tert-butyl N-[3-[[1-(2-bromobenzoyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NC1CCN(C(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C20H28BrN3O4/c1-20(2,3)28-19(27)22-11-8-17(25)23-14-9-12-24(13-10-14)18(26)15-6-4-5-7-16(15)21/h4-7,14H,8-13H2,1-3H3,(H,22,27)(H,23,25) |
| InChIKey | QWWYUMMUFYXHGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |