C18H26BrN3O5 — CID 108548249
tert-butyl N-[3-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate (PubChem CID 108548249) has the molecular formula C18H26BrN3O5 and a molecular weight of 444.33 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108548249 |
| Molecular Formula | C18H26BrN3O5 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | tert-butyl N-[3-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NC1CCN(C(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C18H26BrN3O5/c1-18(2,3)27-17(25)20-9-6-15(23)21-12-7-10-22(11-8-12)16(24)13-4-5-14(19)26-13/h4-5,12H,6-11H2,1-3H3,(H,20,25)(H,21,23) |
| InChIKey | WTKIVCZNUYCYEL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |