C16H21BrN2O5 — CID 108564540
ethyl 4-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-4-oxobutanoate (PubChem CID 108564540) has the molecular formula C16H21BrN2O5 and a molecular weight of 401.26 g/mol. Its IUPAC name is ethyl 4-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 108564540 |
| Molecular Formula | C16H21BrN2O5 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | ethyl 4-[[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC1CCN(C(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C16H21BrN2O5/c1-2-23-15(21)6-5-14(20)18-11-7-9-19(10-8-11)16(22)12-3-4-13(17)24-12/h3-4,11H,2,5-10H2,1H3,(H,18,20) |
| InChIKey | YBCMTQQKXFZYDE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |