C18H24N2O7 — CID 108564420
ethyl 4-oxo-4-[[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]amino]butanoate (PubChem CID 108564420) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl 4-oxo-4-[[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]amino]butanoate.
| Compound Name | ethyl 4-oxo-4-[[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 108564420 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | ethyl 4-oxo-4-[[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]amino]butanoate |
| SMILES | CCOC(=O)CCC(=O)NC1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C18H24N2O7/c1-2-27-16(24)4-3-15(23)19-12-5-7-20(8-6-12)18(26)11-9-13(21)17(25)14(22)10-11/h9-10,12,21-22,25H,2-8H2,1H3,(H,19,23) |
| InChIKey | JXCZVPDUCQEHGM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|