C22H26N2O7 — CID 108552625
2-(2-ethoxyphenoxy)-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]acetamide (PubChem CID 108552625) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108552625 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]acetamide |
| SMILES | CCOc1ccccc1OCC(=O)NC1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C22H26N2O7/c1-2-30-18-5-3-4-6-19(18)31-13-20(27)23-15-7-9-24(10-8-15)22(29)14-11-16(25)21(28)17(26)12-14/h3-6,11-12,15,25-26,28H,2,7-10,13H2,1H3,(H,23,27) |
| InChIKey | KYNWTNPPHQHUSM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|