C22H26N2O6 — CID 108553607
4-phenoxy-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]butanamide (PubChem CID 108553607) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-phenoxy-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]butanamide.
| Compound Name | 4-phenoxy-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108553607 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-phenoxy-N-[1-(3,4,5-trihydroxybenzoyl)piperidin-4-yl]butanamide |
| SMILES | O=C(CCCOc1ccccc1)NC1CCN(C(=O)c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C22H26N2O6/c25-18-13-15(14-19(26)21(18)28)22(29)24-10-8-16(9-11-24)23-20(27)7-4-12-30-17-5-2-1-3-6-17/h1-3,5-6,13-14,16,25-26,28H,4,7-12H2,(H,23,27) |
| InChIKey | HPMXBYOGMBVTJD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|