C26H30N4O3 — CID 108553625
N-[1-(2,3-dimethylquinoxaline-6-carbonyl)piperidin-4-yl]-4-phenoxybutanamide (PubChem CID 108553625) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[1-(2,3-dimethylquinoxaline-6-carbonyl)piperidin-4-yl]-4-phenoxybutanamide.
| Compound Name | N-[1-(2,3-dimethylquinoxaline-6-carbonyl)piperidin-4-yl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 108553625 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-[1-(2,3-dimethylquinoxaline-6-carbonyl)piperidin-4-yl]-4-phenoxybutanamide |
| SMILES | Cc1nc2ccc(C(=O)N3CCC(NC(=O)CCCOc4ccccc4)CC3)cc2nc1C |
| InChI | InChI=1S/C26H30N4O3/c1-18-19(2)28-24-17-20(10-11-23(24)27-18)26(32)30-14-12-21(13-15-30)29-25(31)9-6-16-33-22-7-4-3-5-8-22/h3-5,7-8,10-11,17,21H,6,9,12-16H2,1-2H3,(H,29,31) |
| InChIKey | ZBJOREGSHOLDQM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|