C26H34N2O3 — CID 108553531
N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide (PubChem CID 108553531) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide.
| Compound Name | N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 108553531 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-[1-(3,4-dimethylbenzoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide |
| SMILES | Cc1ccc(C(=O)N2CCC(NC(=O)CCCOc3c(C)cccc3C)CC2)cc1C |
| InChI | InChI=1S/C26H34N2O3/c1-18-10-11-22(17-21(18)4)26(30)28-14-12-23(13-15-28)27-24(29)9-6-16-31-25-19(2)7-5-8-20(25)3/h5,7-8,10-11,17,23H,6,9,12-16H2,1-4H3,(H,27,29) |
| InChIKey | VMHQPNWFJDYYNZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|