C23H36N2O3 — CID 108561132
N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide (PubChem CID 108561132) has the molecular formula C23H36N2O3 and a molecular weight of 388.55 g/mol. Its IUPAC name is N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide.
| Compound Name | N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 108561132 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | N-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-4-(2,6-dimethylphenoxy)butanamide |
| SMILES | Cc1cccc(C)c1OCCCC(=O)NC1CCN(C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H36N2O3/c1-17-8-6-9-18(2)22(17)28-15-7-10-20(26)24-19-11-13-25(14-12-19)21(27)16-23(3,4)5/h6,8-9,19H,7,10-16H2,1-5H3,(H,24,26) |
| InChIKey | XZCQVYFQPFFYGL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|