C26H34N2O4 — CID 108553492
4-(2,6-dimethylphenoxy)-N-[1-[2-(4-methoxyphenyl)acetyl]piperidin-4-yl]butanamide (PubChem CID 108553492) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-N-[1-[2-(4-methoxyphenyl)acetyl]piperidin-4-yl]butanamide.
| Compound Name | 4-(2,6-dimethylphenoxy)-N-[1-[2-(4-methoxyphenyl)acetyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 108553492 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-N-[1-[2-(4-methoxyphenyl)acetyl]piperidin-4-yl]butanamide |
| SMILES | COc1ccc(CC(=O)N2CCC(NC(=O)CCCOc3c(C)cccc3C)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O4/c1-19-6-4-7-20(2)26(19)32-17-5-8-24(29)27-22-13-15-28(16-14-22)25(30)18-21-9-11-23(31-3)12-10-21/h4,6-7,9-12,22H,5,8,13-18H2,1-3H3,(H,27,29) |
| InChIKey | VOJVFRFWZKRTIP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|