C19H17ClN4O4S — CID 56519883
3-[(3-chlorophenyl)sulfonylamino]-N-[2-(3-hydroxyphenyl)pyrimidin-5-yl]propanamide (PubChem CID 56519883) has the molecular formula C19H17ClN4O4S and a molecular weight of 432.89 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)sulfonylamino]-N-[2-(3-hydroxyphenyl)pyrimidin-5-yl]propanamide.
| Compound Name | 3-[(3-chlorophenyl)sulfonylamino]-N-[2-(3-hydroxyphenyl)pyrimidin-5-yl]propanamide |
|---|---|
| PubChem CID | 56519883 |
| Molecular Formula | C19H17ClN4O4S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]-N-[2-(3-hydroxyphenyl)pyrimidin-5-yl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(Cl)c1)Nc1cnc(-c2cccc(O)c2)nc1 |
| InChI | InChI=1S/C19H17ClN4O4S/c20-14-4-2-6-17(10-14)29(27,28)23-8-7-18(26)24-15-11-21-19(22-12-15)13-3-1-5-16(25)9-13/h1-6,9-12,23,25H,7-8H2,(H,24,26) |
| InChIKey | HEEOIGBODMYDLU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |