C12H17ClN2O3S — CID 27648389
3-[(3-chlorophenyl)sulfonylamino]-N-propan-2-ylpropanamide (PubChem CID 27648389) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)sulfonylamino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[(3-chlorophenyl)sulfonylamino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 27648389 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-[(3-chlorophenyl)sulfonylamino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O3S/c1-9(2)15-12(16)6-7-14-19(17,18)11-5-3-4-10(13)8-11/h3-5,8-9,14H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | RVSCIBTWWCHTJN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |