C15H13ClF2N2O3S — CID 26578624
N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]propanamide (PubChem CID 26578624) has the molecular formula C15H13ClF2N2O3S and a molecular weight of 374.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]propanamide.
| Compound Name | N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 26578624 |
| Molecular Formula | C15H13ClF2N2O3S |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)c(F)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClF2N2O3S/c16-10-2-1-3-11(8-10)20-15(21)6-7-19-24(22,23)12-4-5-13(17)14(18)9-12/h1-5,8-9,19H,6-7H2,(H,20,21) |
| InChIKey | NOEGYIWSVPLERN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |