C19H22F2N2O3S — CID 46547078
N-[3-(butylsulfamoyl)phenyl]-3-(3,4-difluorophenyl)propanamide (PubChem CID 46547078) has the molecular formula C19H22F2N2O3S and a molecular weight of 396.46 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-3-(3,4-difluorophenyl)propanamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-3-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 46547078 |
| Molecular Formula | C19H22F2N2O3S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-3-(3,4-difluorophenyl)propanamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)CCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H22F2N2O3S/c1-2-3-11-22-27(25,26)16-6-4-5-15(13-16)23-19(24)10-8-14-7-9-17(20)18(21)12-14/h4-7,9,12-13,22H,2-3,8,10-11H2,1H3,(H,23,24) |
| InChIKey | ABRDOYWFLOLCMA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|