C18H20Cl2N2O3S — CID 17419461
N-[3-(butylsulfamoyl)phenyl]-2-(2,4-dichlorophenyl)acetamide (PubChem CID 17419461) has the molecular formula C18H20Cl2N2O3S and a molecular weight of 415.34 g/mol. Its IUPAC name is N-[3-(butylsulfamoyl)phenyl]-2-(2,4-dichlorophenyl)acetamide.
| Compound Name | N-[3-(butylsulfamoyl)phenyl]-2-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17419461 |
| Molecular Formula | C18H20Cl2N2O3S |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[3-(butylsulfamoyl)phenyl]-2-(2,4-dichlorophenyl)acetamide |
| SMILES | CCCCNS(=O)(=O)c1cccc(NC(=O)Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N2O3S/c1-2-3-9-21-26(24,25)16-6-4-5-15(12-16)22-18(23)10-13-7-8-14(19)11-17(13)20/h4-8,11-12,21H,2-3,9-10H2,1H3,(H,22,23) |
| InChIKey | VCMRVJWWJYSVCY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|