C17H17ClF2N2O3S — CID 55609087
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(3,4-difluorophenyl)propanamide (PubChem CID 55609087) has the molecular formula C17H17ClF2N2O3S and a molecular weight of 402.85 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(3,4-difluorophenyl)propanamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 55609087 |
| Molecular Formula | C17H17ClF2N2O3S |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-(3,4-difluorophenyl)propanamide |
| SMILES | O=C(CCc1ccc(F)c(F)c1)NCCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClF2N2O3S/c18-13-2-1-3-14(11-13)26(24,25)22-9-8-21-17(23)7-5-12-4-6-15(19)16(20)10-12/h1-4,6,10-11,22H,5,7-9H2,(H,21,23) |
| InChIKey | RXBBOVULLAHZLY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|