C15H17N3O3S — CID 42995912
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide (PubChem CID 42995912) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 42995912 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)acetamide |
| SMILES | CC(C)(C)c1csc(NC(=O)Cc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C15H17N3O3S/c1-15(2,3)12-9-22-14(16-12)17-13(19)8-10-4-6-11(7-5-10)18(20)21/h4-7,9H,8H2,1-3H3,(H,16,17,19) |
| InChIKey | NKPZRAMLUPKVPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|