C17H18N2OS2 — CID 142538886
2-(1-benzothiophen-3-yl)-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide (PubChem CID 142538886) has the molecular formula C17H18N2OS2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 142538886 |
| Molecular Formula | C17H18N2OS2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-(4-tert-butyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(C)(C)c1csc(NC(=O)Cc2csc3ccccc23)n1 |
| InChI | InChI=1S/C17H18N2OS2/c1-17(2,3)14-10-22-16(18-14)19-15(20)8-11-9-21-13-7-5-4-6-12(11)13/h4-7,9-10H,8H2,1-3H3,(H,18,19,20) |
| InChIKey | SZQBASPBLXQBCS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |