C18H21N3OS — CID 166629500
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide (PubChem CID 166629500) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 166629500 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide |
| SMILES | Cn1cc(CC(=O)Nc2nc(C(C)(C)C)cs2)c2ccccc21 |
| InChI | InChI=1S/C18H21N3OS/c1-18(2,3)15-11-23-17(19-15)20-16(22)9-12-10-21(4)14-8-6-5-7-13(12)14/h5-8,10-11H,9H2,1-4H3,(H,19,20,22) |
| InChIKey | HRDYVTYERSASLS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |