C15H12N4OS — CID 90603505
N-(5-cyano-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide (PubChem CID 90603505) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-(5-cyano-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide.
| Compound Name | N-(5-cyano-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 90603505 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-(5-cyano-1,3-thiazol-2-yl)-2-(1-methylindol-3-yl)acetamide |
| SMILES | Cn1cc(CC(=O)Nc2ncc(C#N)s2)c2ccccc21 |
| InChI | InChI=1S/C15H12N4OS/c1-19-9-10(12-4-2-3-5-13(12)19)6-14(20)18-15-17-8-11(7-16)21-15/h2-5,8-9H,6H2,1H3,(H,17,18,20) |
| InChIKey | GJYMTYTYUWSZEV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |