C12H8FN3OS — CID 90603616
N-(5-cyano-1,3-thiazol-2-yl)-2-(4-fluorophenyl)acetamide (PubChem CID 90603616) has the molecular formula C12H8FN3OS and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(5-cyano-1,3-thiazol-2-yl)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-(5-cyano-1,3-thiazol-2-yl)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 90603616 |
| Molecular Formula | C12H8FN3OS |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-(5-cyano-1,3-thiazol-2-yl)-2-(4-fluorophenyl)acetamide |
| SMILES | N#Cc1cnc(NC(=O)Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C12H8FN3OS/c13-9-3-1-8(2-4-9)5-11(17)16-12-15-7-10(6-14)18-12/h1-4,7H,5H2,(H,15,16,17) |
| InChIKey | LOANHFDTUUCSKT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |