C6H4ClN3OS — CID 166432032
2-chloro-N-(5-cyano-1,3-thiazol-2-yl)acetamide (PubChem CID 166432032) has the molecular formula C6H4ClN3OS and a molecular weight of 201.64 g/mol. Its IUPAC name is 2-chloro-N-(5-cyano-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-chloro-N-(5-cyano-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 166432032 |
| Molecular Formula | C6H4ClN3OS |
| Molecular Weight | 201.64 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | 2-chloro-N-(5-cyano-1,3-thiazol-2-yl)acetamide |
| SMILES | N#Cc1cnc(NC(=O)CCl)s1 |
| InChI | InChI=1S/C6H4ClN3OS/c7-1-5(11)10-6-9-3-4(2-8)12-6/h3H,1H2,(H,9,10,11) |
| InChIKey | BLAJRDWJMCBLFB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.64 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|