C11H15N3OS — CID 164639869
(2S)-N-(5-cyano-1,3-thiazol-2-yl)-2-methylhexanamide (PubChem CID 164639869) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is (2S)-N-(5-cyano-1,3-thiazol-2-yl)-2-methylhexanamide.
| Compound Name | (2S)-N-(5-cyano-1,3-thiazol-2-yl)-2-methylhexanamide |
|---|---|
| PubChem CID | 164639869 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (2S)-N-(5-cyano-1,3-thiazol-2-yl)-2-methylhexanamide |
| SMILES | CCCC[C@H](C)C(=O)Nc1ncc(C#N)s1 |
| InChI | InChI=1S/C11H15N3OS/c1-3-4-5-8(2)10(15)14-11-13-7-9(6-12)16-11/h7-8H,3-5H2,1-2H3,(H,13,14,15)/t8-/m0/s1 |
| InChIKey | QCEHECVUPJRIMV-QMMMGPOBSA-N |
| XLogP | 2.78 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |