C21H20N4OS — CID 166872979
4-(butylamino)-N-(5-cyano-1,3-thiazol-2-yl)-2-phenylbenzamide (PubChem CID 166872979) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-(butylamino)-N-(5-cyano-1,3-thiazol-2-yl)-2-phenylbenzamide.
| Compound Name | 4-(butylamino)-N-(5-cyano-1,3-thiazol-2-yl)-2-phenylbenzamide |
|---|---|
| PubChem CID | 166872979 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4-(butylamino)-N-(5-cyano-1,3-thiazol-2-yl)-2-phenylbenzamide |
| SMILES | CCCCNc1ccc(C(=O)Nc2ncc(C#N)s2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H20N4OS/c1-2-3-11-23-16-9-10-18(19(12-16)15-7-5-4-6-8-15)20(26)25-21-24-14-17(13-22)27-21/h4-10,12,14,23H,2-3,11H2,1H3,(H,24,25,26) |
| InChIKey | GJMCQZZACREDCC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|