C21H24ClN3OS — CID 166873108
4-(butylamino)-N-(5-chloro-4-methyl-2,3-dihydro-1,3-thiazol-2-yl)-2-phenylbenzamide (PubChem CID 166873108) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is 4-(butylamino)-N-(5-chloro-4-methyl-2,3-dihydro-1,3-thiazol-2-yl)-2-phenylbenzamide.
| Compound Name | 4-(butylamino)-N-(5-chloro-4-methyl-2,3-dihydro-1,3-thiazol-2-yl)-2-phenylbenzamide |
|---|---|
| PubChem CID | 166873108 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-(butylamino)-N-(5-chloro-4-methyl-2,3-dihydro-1,3-thiazol-2-yl)-2-phenylbenzamide |
| SMILES | CCCCNc1ccc(C(=O)NC2NC(C)=C(Cl)S2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H24ClN3OS/c1-3-4-12-23-16-10-11-17(18(13-16)15-8-6-5-7-9-15)20(26)25-21-24-14(2)19(22)27-21/h5-11,13,21,23-24H,3-4,12H2,1-2H3,(H,25,26) |
| InChIKey | LVHMRYWJCPYCRX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|