C21H20F3N3OS — CID 166872971
4-(butylamino)-2-phenyl-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 166872971) has the molecular formula C21H20F3N3OS and a molecular weight of 419.47 g/mol. Its IUPAC name is 4-(butylamino)-2-phenyl-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(butylamino)-2-phenyl-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 166872971 |
| Molecular Formula | C21H20F3N3OS |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-(butylamino)-2-phenyl-N-[5-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCNc1ccc(C(=O)Nc2ncc(C(F)(F)F)s2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H20F3N3OS/c1-2-3-11-25-15-9-10-16(17(12-15)14-7-5-4-6-8-14)19(28)27-20-26-13-18(29-20)21(22,23)24/h4-10,12-13,25H,2-3,11H2,1H3,(H,26,27,28) |
| InChIKey | MHYBBOHYAUBBCR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|