C24H30ClN3 — CID 162063457
4-chloro-N-nonyl-3-(5-phenyl-1H-imidazol-2-yl)aniline (PubChem CID 162063457) has the molecular formula C24H30ClN3 and a molecular weight of 395.98 g/mol. Its IUPAC name is 4-chloro-N-nonyl-3-(5-phenyl-1H-imidazol-2-yl)aniline.
| Compound Name | 4-chloro-N-nonyl-3-(5-phenyl-1H-imidazol-2-yl)aniline |
|---|---|
| PubChem CID | 162063457 |
| Molecular Formula | C24H30ClN3 |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-chloro-N-nonyl-3-(5-phenyl-1H-imidazol-2-yl)aniline |
| SMILES | CCCCCCCCCNc1ccc(Cl)c(-c2ncc(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C24H30ClN3/c1-2-3-4-5-6-7-11-16-26-20-14-15-22(25)21(17-20)24-27-18-23(28-24)19-12-9-8-10-13-19/h8-10,12-15,17-18,26H,2-7,11,16H2,1H3,(H,27,28) |
| InChIKey | KGRARHWLYHCYFG-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|