C23H17Cl2N3O3S — CID 58006484
2-chloro-N-[4-chloro-3-(5-phenyl-1H-imidazol-2-yl)phenyl]-4-methylsulfonylbenzamide (PubChem CID 58006484) has the molecular formula C23H17Cl2N3O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is 2-chloro-N-[4-chloro-3-(5-phenyl-1H-imidazol-2-yl)phenyl]-4-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[4-chloro-3-(5-phenyl-1H-imidazol-2-yl)phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 58006484 |
| Molecular Formula | C23H17Cl2N3O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 2-chloro-N-[4-chloro-3-(5-phenyl-1H-imidazol-2-yl)phenyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(-c3ncc(-c4ccccc4)[nH]3)c2)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3O3S/c1-32(30,31)16-8-9-17(20(25)12-16)23(29)27-15-7-10-19(24)18(11-15)22-26-13-21(28-22)14-5-3-2-4-6-14/h2-13H,1H3,(H,26,28)(H,27,29) |
| InChIKey | KKADZMQXVFFSHF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |