C19H14Cl2N2O3S — CID 91971550
2-chloro-N-(4-chloro-3-pyridin-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-4-(trideuterio(113C)methylsulfonyl)benzamide (PubChem CID 91971550) has the molecular formula C19H14Cl2N2O3S and a molecular weight of 431.27 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-pyridin-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-4-(trideuterio(113C)methylsulfonyl)benzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-pyridin-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-4-(trideuterio(113C)methylsulfonyl)benzamide |
|---|---|
| PubChem CID | 91971550 |
| Molecular Formula | C19H14Cl2N2O3S |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-pyridin-2-yl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-4-(trideuterio(113C)methylsulfonyl)benzamide |
| SMILES | [2H][13C]([2H])([2H])S(=O)(=O)c1ccc(C(=O)N[13c]2[13cH][13cH][13c](Cl)[13c](-c3ccccn3)[13cH]2)c(Cl)c1 |
| InChI | InChI=1S/C19H14Cl2N2O3S/c1-27(25,26)13-6-7-14(17(21)11-13)19(24)23-12-5-8-16(20)15(10-12)18-4-2-3-9-22-18/h2-11H,1H3,(H,23,24)/i1+1D3,5+1,8+1,10+1,12+1,15+1,16+1 |
| InChIKey | BPQMGSKTAYIVFO-VVZZPNEESA-N |
| XLogP | 4.71 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |