C25H17Cl2FN2O3S — CID 70797233
2-(3-chloro-2-fluorophenyl)-N-(4-chloro-3-pyridin-2-ylphenyl)-4-methylsulfonylbenzamide (PubChem CID 70797233) has the molecular formula C25H17Cl2FN2O3S and a molecular weight of 515.39 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-N-(4-chloro-3-pyridin-2-ylphenyl)-4-methylsulfonylbenzamide.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-N-(4-chloro-3-pyridin-2-ylphenyl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 70797233 |
| Molecular Formula | C25H17Cl2FN2O3S |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-N-(4-chloro-3-pyridin-2-ylphenyl)-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)c(-c2cccc(Cl)c2F)c1 |
| InChI | InChI=1S/C25H17Cl2FN2O3S/c1-34(32,33)16-9-10-18(19(14-16)17-5-4-6-22(27)24(17)28)25(31)30-15-8-11-21(26)20(13-15)23-7-2-3-12-29-23/h2-14H,1H3,(H,30,31) |
| InChIKey | LCRQKFVIHUNJCP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |