C26H20ClFN2OS — CID 123710564
N-(4-chloro-3-pyridin-2-ylphenyl)-2-(2-fluoro-5-methylphenyl)-4-methylsulfanylbenzamide (PubChem CID 123710564) has the molecular formula C26H20ClFN2OS and a molecular weight of 462.98 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-2-(2-fluoro-5-methylphenyl)-4-methylsulfanylbenzamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-2-(2-fluoro-5-methylphenyl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 123710564 |
| Molecular Formula | C26H20ClFN2OS |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-2-(2-fluoro-5-methylphenyl)-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)c(-c2cc(C)ccc2F)c1 |
| InChI | InChI=1S/C26H20ClFN2OS/c1-16-6-11-24(28)21(13-16)20-15-18(32-2)8-9-19(20)26(31)30-17-7-10-23(27)22(14-17)25-5-3-4-12-29-25/h3-15H,1-2H3,(H,30,31) |
| InChIKey | SQVOSBSCWMEDSV-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |