C27H20Cl2N4O5S — CID 123578164
2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfamoyl]benzamide (PubChem CID 123578164) has the molecular formula C27H20Cl2N4O5S and a molecular weight of 583.45 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 123578164 |
| Molecular Formula | C27H20Cl2N4O5S |
| Molecular Weight | 583.45 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfamoyl]benzamide |
| SMILES | O=C(C=Cc1ccc(NS(=O)(=O)c2ccc(C(=O)Nc3ccc(Cl)c(-c4ccccn4)c3)c(Cl)c2)cc1)NO |
| InChI | InChI=1S/C27H20Cl2N4O5S/c28-23-12-9-19(15-22(23)25-3-1-2-14-30-25)31-27(35)21-11-10-20(16-24(21)29)39(37,38)33-18-7-4-17(5-8-18)6-13-26(34)32-36/h1-16,33,36H,(H,31,35)(H,32,34) |
| InChIKey | XZJVEOFRIDDWDP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|