C20H16Cl2N2O3S — CID 143198912
2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfinyl)benzamide (PubChem CID 143198912) has the molecular formula C20H16Cl2N2O3S and a molecular weight of 435.33 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfinyl)benzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfinyl)benzamide |
|---|---|
| PubChem CID | 143198912 |
| Molecular Formula | C20H16Cl2N2O3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-pyridin-2-ylphenyl)-4-(2-hydroxyethylsulfinyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccccn2)c1)c1ccc(S(=O)CCO)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N2O3S/c21-17-7-4-13(11-16(17)19-3-1-2-8-23-19)24-20(26)15-6-5-14(12-18(15)22)28(27)10-9-25/h1-8,11-12,25H,9-10H2,(H,24,26) |
| InChIKey | ISNRGWATWJMTNM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |