C29H21Cl2N5O5S — CID 123993653
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-2-chloro-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]benzamide (PubChem CID 123993653) has the molecular formula C29H21Cl2N5O5S and a molecular weight of 622.49 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-2-chloro-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]benzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-2-chloro-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 123993653 |
| Molecular Formula | C29H21Cl2N5O5S |
| Molecular Weight | 622.49 g/mol |
| Exact Mass | 621.06 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-2-chloro-4-[[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]sulfonylamino]benzamide |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(Cl)c(-c4nc5ccccc5[nH]4)c3)c(Cl)c2)cc1)NO |
| InChI | InChI=1S/C29H21Cl2N5O5S/c30-23-13-9-18(15-22(23)28-33-25-3-1-2-4-26(25)34-28)32-29(38)21-12-8-19(16-24(21)31)36-42(40,41)20-10-5-17(6-11-20)7-14-27(37)35-39/h1-16,36,39H,(H,32,38)(H,33,34)(H,35,37) |
| InChIKey | BHJPWIYCACIYKI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|