C17H12ClN3O2S2 — CID 71229061
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]thiophene-2-sulfonamide (PubChem CID 71229061) has the molecular formula C17H12ClN3O2S2 and a molecular weight of 389.89 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 71229061 |
| Molecular Formula | C17H12ClN3O2S2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1)c1cccs1 |
| InChI | InChI=1S/C17H12ClN3O2S2/c18-13-8-7-11(21-25(22,23)16-6-3-9-24-16)10-12(13)17-19-14-4-1-2-5-15(14)20-17/h1-10,21H,(H,19,20) |
| InChIKey | JCFXYFNPAKLZEX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |