C13H12N4O4S2 — CID 57371868
methyl-[6-(thiophen-2-ylsulfonylamino)-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 57371868) has the molecular formula C13H12N4O4S2 and a molecular weight of 352.40 g/mol. Its IUPAC name is methyl-[6-(thiophen-2-ylsulfonylamino)-1H-benzimidazol-2-yl]carbamic acid.
| Compound Name | methyl-[6-(thiophen-2-ylsulfonylamino)-1H-benzimidazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 57371868 |
| Molecular Formula | C13H12N4O4S2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | methyl-[6-(thiophen-2-ylsulfonylamino)-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | CN(C(=O)O)c1nc2ccc(NS(=O)(=O)c3cccs3)cc2[nH]1 |
| InChI | InChI=1S/C13H12N4O4S2/c1-17(13(18)19)12-14-9-5-4-8(7-10(9)15-12)16-23(20,21)11-3-2-6-22-11/h2-7,16H,1H3,(H,14,15)(H,18,19) |
| InChIKey | HSLIYBUUGLWDLX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |