C12H11ClN4O2S2 — CID 155537094
N-(2-aminoquinazolin-6-yl)thiophene-2-sulfonamide;hydrochloride (PubChem CID 155537094) has the molecular formula C12H11ClN4O2S2 and a molecular weight of 342.83 g/mol. Its IUPAC name is N-(2-aminoquinazolin-6-yl)thiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(2-aminoquinazolin-6-yl)thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 155537094 |
| Molecular Formula | C12H11ClN4O2S2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | N-(2-aminoquinazolin-6-yl)thiophene-2-sulfonamide;hydrochloride |
| SMILES | Cl.Nc1ncc2cc(NS(=O)(=O)c3cccs3)ccc2n1 |
| InChI | InChI=1S/C12H10N4O2S2.ClH/c13-12-14-7-8-6-9(3-4-10(8)15-12)16-20(17,18)11-2-1-5-19-11;/h1-7,16H,(H2,13,14,15);1H |
| InChIKey | WNZVQUDEHVXWMN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |