C11H8NO5S2- — CID 54711268
2-carboxy-4-(thiophen-2-ylsulfonylamino)phenolate (PubChem CID 54711268) has the molecular formula C11H8NO5S2- and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-carboxy-4-(thiophen-2-ylsulfonylamino)phenolate.
| Compound Name | 2-carboxy-4-(thiophen-2-ylsulfonylamino)phenolate |
|---|---|
| PubChem CID | 54711268 |
| Molecular Formula | C11H8NO5S2- |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-carboxy-4-(thiophen-2-ylsulfonylamino)phenolate |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2cccs2)ccc1[O-] |
| InChI | InChI=1S/C11H9NO5S2/c13-9-4-3-7(6-8(9)11(14)15)12-19(16,17)10-2-1-5-18-10/h1-6,12-13H,(H,14,15)/p-1 |
| InChIKey | AVIOICZIPMVMFG-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |