C25H24N4O5S2 — CID 46298178
2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(thiophen-2-ylsulfonylamino)quinoline-4-carboxylic acid (PubChem CID 46298178) has the molecular formula C25H24N4O5S2 and a molecular weight of 524.62 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(thiophen-2-ylsulfonylamino)quinoline-4-carboxylic acid.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(thiophen-2-ylsulfonylamino)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 46298178 |
| Molecular Formula | C25H24N4O5S2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-6-(thiophen-2-ylsulfonylamino)quinoline-4-carboxylic acid |
| SMILES | COc1ccc(N2CCN(c3cc(C(=O)O)c4cc(NS(=O)(=O)c5cccs5)ccc4n3)CC2)cc1 |
| InChI | InChI=1S/C25H24N4O5S2/c1-34-19-7-5-18(6-8-19)28-10-12-29(13-11-28)23-16-21(25(30)31)20-15-17(4-9-22(20)26-23)27-36(32,33)24-3-2-14-35-24/h2-9,14-16,27H,10-13H2,1H3,(H,30,31) |
| InChIKey | POFHEDUAIXOFCV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|