C28H26N4O4 — CID 50784035
6-[(4-methoxybenzoyl)amino]-2-(4-phenylpiperazin-1-yl)quinoline-4-carboxylic acid (PubChem CID 50784035) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 6-[(4-methoxybenzoyl)amino]-2-(4-phenylpiperazin-1-yl)quinoline-4-carboxylic acid.
| Compound Name | 6-[(4-methoxybenzoyl)amino]-2-(4-phenylpiperazin-1-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 50784035 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 6-[(4-methoxybenzoyl)amino]-2-(4-phenylpiperazin-1-yl)quinoline-4-carboxylic acid |
| SMILES | COc1ccc(C(=O)Nc2ccc3nc(N4CCN(c5ccccc5)CC4)cc(C(=O)O)c3c2)cc1 |
| InChI | InChI=1S/C28H26N4O4/c1-36-22-10-7-19(8-11-22)27(33)29-20-9-12-25-23(17-20)24(28(34)35)18-26(30-25)32-15-13-31(14-16-32)21-5-3-2-4-6-21/h2-12,17-18H,13-16H2,1H3,(H,29,33)(H,34,35) |
| InChIKey | XPHALECSPQOQIM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |