C16H12N4O2S2 — CID 59243189
N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 59243189) has the molecular formula C16H12N4O2S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59243189 |
| Molecular Formula | C16H12N4O2S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2nc3ncccc3[nH]2)c1)c1cccs1 |
| InChI | InChI=1S/C16H12N4O2S2/c21-24(22,14-7-3-9-23-14)20-12-5-1-4-11(10-12)15-18-13-6-2-8-17-16(13)19-15/h1-10,20H,(H,17,18,19) |
| InChIKey | WWSHRTATUUNFTE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |