C17H13N3O2S2 — CID 122283303
N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-sulfonamide (PubChem CID 122283303) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122283303 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2cn3ccccc3n2)c1)c1cccs1 |
| InChI | InChI=1S/C17H13N3O2S2/c21-24(22,17-8-4-10-23-17)19-14-6-3-5-13(11-14)15-12-20-9-2-1-7-16(20)18-15/h1-12,19H |
| InChIKey | AHSFZWUWSFDWHV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |