C21H20N4O3S2 — CID 67113911
N-[3-[2-amino-1-[(2-methoxyphenyl)methyl]imidazol-4-yl]phenyl]thiophene-2-sulfonamide (PubChem CID 67113911) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[3-[2-amino-1-[(2-methoxyphenyl)methyl]imidazol-4-yl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[2-amino-1-[(2-methoxyphenyl)methyl]imidazol-4-yl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 67113911 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[3-[2-amino-1-[(2-methoxyphenyl)methyl]imidazol-4-yl]phenyl]thiophene-2-sulfonamide |
| SMILES | COc1ccccc1Cn1cc(-c2cccc(NS(=O)(=O)c3cccs3)c2)nc1N |
| InChI | InChI=1S/C21H20N4O3S2/c1-28-19-9-3-2-6-16(19)13-25-14-18(23-21(25)22)15-7-4-8-17(12-15)24-30(26,27)20-10-5-11-29-20/h2-12,14,24H,13H2,1H3,(H2,22,23) |
| InChIKey | OZPOANNIGDZXAQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |