C14H18N3O3S2+ — CID 7197527
[amino-(thiophen-2-ylsulfonylamino)methylidene]-[2-(2-methoxyphenyl)ethyl]azanium (PubChem CID 7197527) has the molecular formula C14H18N3O3S2+ and a molecular weight of 340.45 g/mol. Its IUPAC name is [amino-(thiophen-2-ylsulfonylamino)methylidene]-[2-(2-methoxyphenyl)ethyl]azanium.
| Compound Name | [amino-(thiophen-2-ylsulfonylamino)methylidene]-[2-(2-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 7197527 |
| Molecular Formula | C14H18N3O3S2+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [amino-(thiophen-2-ylsulfonylamino)methylidene]-[2-(2-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccccc1CC/[NH+]=C(\N)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-20-12-6-3-2-5-11(12)8-9-16-14(15)17-22(18,19)13-7-4-10-21-13/h2-7,10H,8-9H2,1H3,(H3,15,16,17)/p+1 |
| InChIKey | ODEVUVJKEJILRE-UHFFFAOYSA-O |
| XLogP | -0.33 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|