C17H22N3O4S+ — CID 7197549
[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]-[2-(2-methoxyphenyl)ethyl]azanium (PubChem CID 7197549) has the molecular formula C17H22N3O4S+ and a molecular weight of 364.45 g/mol. Its IUPAC name is [amino-[(4-methoxyphenyl)sulfonylamino]methylidene]-[2-(2-methoxyphenyl)ethyl]azanium.
| Compound Name | [amino-[(4-methoxyphenyl)sulfonylamino]methylidene]-[2-(2-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 7197549 |
| Molecular Formula | C17H22N3O4S+ |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [amino-[(4-methoxyphenyl)sulfonylamino]methylidene]-[2-(2-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccc(S(=O)(=O)N/C(N)=[NH+]/CCc2ccccc2OC)cc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-23-14-7-9-15(10-8-14)25(21,22)20-17(18)19-12-11-13-5-3-4-6-16(13)24-2/h3-10H,11-12H2,1-2H3,(H3,18,19,20)/p+1 |
| InChIKey | ZCEPROMFKOZKPK-UHFFFAOYSA-O |
| XLogP | -0.38 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|